C24H22FN7O2S — CID 56838699
[4-(2-aminopyrimidin-5-yl)-6-morpholin-4-yl-8-thia-3,5,12-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5-tetraen-12-yl]-(4-fluorophenyl)methanone (PubChem CID 56838699) has the molecular formula C24H22FN7O2S and a molecular weight of 491.55 g/mol. Its IUPAC name is [4-(2-aminopyrimidin-5-yl)-6-morpholin-4-yl-8-thia-3,5,12-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5-tetraen-12-yl]-(4-fluorophenyl)methanone.
| Compound Name | [4-(2-aminopyrimidin-5-yl)-6-morpholin-4-yl-8-thia-3,5,12-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5-tetraen-12-yl]-(4-fluorophenyl)methanone |
|---|---|
| PubChem CID | 56838699 |
| Molecular Formula | C24H22FN7O2S |
| Molecular Weight | 491.55 g/mol |
| Exact Mass | 491.15 |
| IUPAC Name | [4-(2-aminopyrimidin-5-yl)-6-morpholin-4-yl-8-thia-3,5,12-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5-tetraen-12-yl]-(4-fluorophenyl)methanone |
| SMILES | Nc1ncc(-c2nc(N3CCOCC3)c3sc4c(c3n2)CN(C(=O)c2ccc(F)cc2)CC4)cn1 |
| InChI | InChI=1S/C24H22FN7O2S/c25-16-3-1-14(2-4-16)23(33)32-6-5-18-17(13-32)19-20(35-18)22(31-7-9-34-10-8-31)30-21(29-19)15-11-27-24(26)28-12-15/h1-4,11-12H,5-10,13H2,(H2,26,27,28) |
| InChIKey | WRUULXYPAGSLCF-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 110.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.55 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |