C28H20Cl2FN3 — CID 118916077
6-[bis(4-chlorophenyl)methyl]-N-[(3-fluorophenyl)methyl]quinazolin-4-amine (PubChem CID 118916077) has the molecular formula C28H20Cl2FN3 and a molecular weight of 488.39 g/mol. Its IUPAC name is 6-[bis(4-chlorophenyl)methyl]-N-[(3-fluorophenyl)methyl]quinazolin-4-amine.
| Compound Name | 6-[bis(4-chlorophenyl)methyl]-N-[(3-fluorophenyl)methyl]quinazolin-4-amine |
|---|---|
| PubChem CID | 118916077 |
| Molecular Formula | C28H20Cl2FN3 |
| Molecular Weight | 488.39 g/mol |
| Exact Mass | 487.10 |
| IUPAC Name | 6-[bis(4-chlorophenyl)methyl]-N-[(3-fluorophenyl)methyl]quinazolin-4-amine |
| SMILES | Fc1cccc(CNc2ncnc3ccc(C(c4ccc(Cl)cc4)c4ccc(Cl)cc4)cc23)c1 |
| InChI | InChI=1S/C28H20Cl2FN3/c29-22-9-4-19(5-10-22)27(20-6-11-23(30)12-7-20)21-8-13-26-25(15-21)28(34-17-33-26)32-16-18-2-1-3-24(31)14-18/h1-15,17,27H,16H2,(H,32,33,34) |
| InChIKey | SDVMBMPIABHSSR-UHFFFAOYSA-N |
| XLogP | 7.87 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.39 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|