C23H23ClN2O6S — CID 118917454
2-[2-(3-chlorophenyl)-6-[3-(methylsulfonyloxymethyl)cyclobutyl]-4-oxoquinazolin-3-yl]propanoic acid (PubChem CID 118917454) has the molecular formula C23H23ClN2O6S and a molecular weight of 490.97 g/mol. Its IUPAC name is 2-[2-(3-chlorophenyl)-6-[3-(methylsulfonyloxymethyl)cyclobutyl]-4-oxoquinazolin-3-yl]propanoic acid.
| Compound Name | 2-[2-(3-chlorophenyl)-6-[3-(methylsulfonyloxymethyl)cyclobutyl]-4-oxoquinazolin-3-yl]propanoic acid |
|---|---|
| PubChem CID | 118917454 |
| Molecular Formula | C23H23ClN2O6S |
| Molecular Weight | 490.97 g/mol |
| Exact Mass | 490.10 |
| IUPAC Name | 2-[2-(3-chlorophenyl)-6-[3-(methylsulfonyloxymethyl)cyclobutyl]-4-oxoquinazolin-3-yl]propanoic acid |
| SMILES | CC(C(=O)O)n1c(-c2cccc(Cl)c2)nc2ccc(C3CC(COS(C)(=O)=O)C3)cc2c1=O |
| InChI | InChI=1S/C23H23ClN2O6S/c1-13(23(28)29)26-21(16-4-3-5-18(24)10-16)25-20-7-6-15(11-19(20)22(26)27)17-8-14(9-17)12-32-33(2,30)31/h3-7,10-11,13-14,17H,8-9,12H2,1-2H3,(H,28,29) |
| InChIKey | LCGMBCGEWFEVOF-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 115.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.97 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|