C24H44N6O4 — CID 118920883
octyl N-methyl-N-[4-(methylamino)-6-[methyl(octoxycarbonyl)amino]-1,3,5-triazin-2-yl]carbamate (PubChem CID 118920883) has the molecular formula C24H44N6O4 and a molecular weight of 480.65 g/mol. Its IUPAC name is octyl N-methyl-N-[4-(methylamino)-6-[methyl(octoxycarbonyl)amino]-1,3,5-triazin-2-yl]carbamate.
| Compound Name | octyl N-methyl-N-[4-(methylamino)-6-[methyl(octoxycarbonyl)amino]-1,3,5-triazin-2-yl]carbamate |
|---|---|
| PubChem CID | 118920883 |
| Molecular Formula | C24H44N6O4 |
| Molecular Weight | 480.65 g/mol |
| Exact Mass | 480.34 |
| IUPAC Name | octyl N-methyl-N-[4-(methylamino)-6-[methyl(octoxycarbonyl)amino]-1,3,5-triazin-2-yl]carbamate |
| SMILES | CCCCCCCCOC(=O)N(C)c1nc(NC)nc(N(C)C(=O)OCCCCCCCC)n1 |
| InChI | InChI=1S/C24H44N6O4/c1-6-8-10-12-14-16-18-33-23(31)29(4)21-26-20(25-3)27-22(28-21)30(5)24(32)34-19-17-15-13-11-9-7-2/h6-19H2,1-5H3,(H,25,26,27,28) |
| InChIKey | FJHGZUAFGHZLPK-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 109.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.65 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|