C24H38N2O4 — CID 118922632
[2,6,6,7,7,8,11-heptadeuterio-9,10-dimethoxy-3-(2-methylpropyl)-1,3,4,11b-tetrahydrobenzo[a]quinolizin-2-yl] (2S)-2-amino-2,3,4,4,4-pentadeuterio-3-(trideuteriomethyl)butanoate (PubChem CID 118922632) has the molecular formula C24H38N2O4 and a molecular weight of 433.67 g/mol. Its IUPAC name is [2,6,6,7,7,8,11-heptadeuterio-9,10-dimethoxy-3-(2-methylpropyl)-1,3,4,11b-tetrahydrobenzo[a]quinolizin-2-yl] (2S)-2-amino-2,3,4,4,4-pentadeuterio-3-(trideuteriomethyl)butanoate.
| Compound Name | [2,6,6,7,7,8,11-heptadeuterio-9,10-dimethoxy-3-(2-methylpropyl)-1,3,4,11b-tetrahydrobenzo[a]quinolizin-2-yl] (2S)-2-amino-2,3,4,4,4-pentadeuterio-3-(trideuteriomethyl)butanoate |
|---|---|
| PubChem CID | 118922632 |
| Molecular Formula | C24H38N2O4 |
| Molecular Weight | 433.67 g/mol |
| Exact Mass | 433.38 |
| IUPAC Name | [2,6,6,7,7,8,11-heptadeuterio-9,10-dimethoxy-3-(2-methylpropyl)-1,3,4,11b-tetrahydrobenzo[a]quinolizin-2-yl] (2S)-2-amino-2,3,4,4,4-pentadeuterio-3-(trideuteriomethyl)butanoate |
| SMILES | [2H]c1c(OC)c(OC)c([2H])c2c1C1CC([2H])(OC(=O)[C@]([2H])(N)C([2H])(C([2H])([2H])[2H])C([2H])([2H])[2H])C(CC(C)C)CN1C([2H])([2H])C2([2H])[2H] |
| InChI | InChI=1S/C24H38N2O4/c1-14(2)9-17-13-26-8-7-16-10-21(28-5)22(29-6)11-18(16)19(26)12-20(17)30-24(27)23(25)15(3)4/h10-11,14-15,17,19-20,23H,7-9,12-13,25H2,1-6H3/t17?,19?,20?,23-/m1/s1/i3D3,4D3,7D2,8D2,10D,11D,15D,20D,23D |
| InChIKey | GEJDGVNQKABXKG-PABQGJLESA-N |
| XLogP | 3.56 |
| TPSA | 74.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.67 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |