C25H40N2O4 — CID 159784765
[1,1,3,4,4,6,6,7,7,8,11-undecadeuterio-9,10-dimethoxy-3-(2,3,4,4,4-pentadeuterio-3-methylbutan-2-yl)-2,11b-dihydrobenzo[a]quinolizin-2-yl] (2S)-2-amino-3-methylbutanoate (PubChem CID 159784765) has the molecular formula C25H40N2O4 and a molecular weight of 448.70 g/mol. Its IUPAC name is [1,1,3,4,4,6,6,7,7,8,11-undecadeuterio-9,10-dimethoxy-3-(2,3,4,4,4-pentadeuterio-3-methylbutan-2-yl)-2,11b-dihydrobenzo[a]quinolizin-2-yl] (2S)-2-amino-3-methylbutanoate.
| Compound Name | [1,1,3,4,4,6,6,7,7,8,11-undecadeuterio-9,10-dimethoxy-3-(2,3,4,4,4-pentadeuterio-3-methylbutan-2-yl)-2,11b-dihydrobenzo[a]quinolizin-2-yl] (2S)-2-amino-3-methylbutanoate |
|---|---|
| PubChem CID | 159784765 |
| Molecular Formula | C25H40N2O4 |
| Molecular Weight | 448.70 g/mol |
| Exact Mass | 448.40 |
| IUPAC Name | [1,1,3,4,4,6,6,7,7,8,11-undecadeuterio-9,10-dimethoxy-3-(2,3,4,4,4-pentadeuterio-3-methylbutan-2-yl)-2,11b-dihydrobenzo[a]quinolizin-2-yl] (2S)-2-amino-3-methylbutanoate |
| SMILES | [2H]c1c(OC)c(OC)c([2H])c2c1C1N(C([2H])([2H])C2([2H])[2H])C([2H])([2H])C([2H])(C([2H])(C)C([2H])(C)C([2H])([2H])[2H])C(OC(=O)[C@@H](N)C(C)C)C1([2H])[2H] |
| InChI | InChI=1S/C25H40N2O4/c1-14(2)16(5)19-13-27-9-8-17-10-22(29-6)23(30-7)11-18(17)20(27)12-21(19)31-25(28)24(26)15(3)4/h10-11,14-16,19-21,24H,8-9,12-13,26H2,1-7H3/t16?,19?,20?,21?,24-/m0/s1/i1D3,8D2,9D2,10D,11D,12D2,13D2,14D,16D,19D/t14?,16?,19?,20?,21?,24- |
| InChIKey | XTXWWFGSTUIDQX-PDHIXZCLSA-N |
| XLogP | 3.81 |
| TPSA | 74.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.70 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |