C11H25N3O — CID 118924469
1-[(4-methylpiperazin-1-yl)amino]hexan-2-ol (PubChem CID 118924469) has the molecular formula C11H25N3O and a molecular weight of 215.34 g/mol. Its IUPAC name is 1-[(4-methylpiperazin-1-yl)amino]hexan-2-ol.
| Compound Name | 1-[(4-methylpiperazin-1-yl)amino]hexan-2-ol |
|---|---|
| PubChem CID | 118924469 |
| Molecular Formula | C11H25N3O |
| Molecular Weight | 215.34 g/mol |
| Exact Mass | 215.20 |
| IUPAC Name | 1-[(4-methylpiperazin-1-yl)amino]hexan-2-ol |
| SMILES | CCCCC(O)CNN1CCN(C)CC1 |
| InChI | InChI=1S/C11H25N3O/c1-3-4-5-11(15)10-12-14-8-6-13(2)7-9-14/h11-12,15H,3-10H2,1-2H3 |
| InChIKey | FYCGRXUFMNXYNY-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 38.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.34 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |