C23H22N6O5 — CID 118926683
9-hydroxy-8-nitro-2-[4-(2-pyrrolidin-1-ylethoxy)anilino]-5H-pyrimido[5,4-c]isoquinolin-6-one (PubChem CID 118926683) has the molecular formula C23H22N6O5 and a molecular weight of 462.47 g/mol. Its IUPAC name is 9-hydroxy-8-nitro-2-[4-(2-pyrrolidin-1-ylethoxy)anilino]-5H-pyrimido[5,4-c]isoquinolin-6-one.
| Compound Name | 9-hydroxy-8-nitro-2-[4-(2-pyrrolidin-1-ylethoxy)anilino]-5H-pyrimido[5,4-c]isoquinolin-6-one |
|---|---|
| PubChem CID | 118926683 |
| Molecular Formula | C23H22N6O5 |
| Molecular Weight | 462.47 g/mol |
| Exact Mass | 462.17 |
| IUPAC Name | 9-hydroxy-8-nitro-2-[4-(2-pyrrolidin-1-ylethoxy)anilino]-5H-pyrimido[5,4-c]isoquinolin-6-one |
| SMILES | O=c1[nH]c2cnc(Nc3ccc(OCCN4CCCC4)cc3)nc2c2cc(O)c([N+](=O)[O-])cc12 |
| InChI | InChI=1S/C23H22N6O5/c30-20-12-16-17(11-19(20)29(32)33)22(31)26-18-13-24-23(27-21(16)18)25-14-3-5-15(6-4-14)34-10-9-28-7-1-2-8-28/h3-6,11-13,30H,1-2,7-10H2,(H,26,31)(H,24,25,27) |
| InChIKey | CKJDWWYWPGULDY-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 146.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.47 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|