C35H38N2 — CID 118927448
4-(2-tert-butyl-6-methylphenyl)-2,9-dimethyl-7-(2-methyl-6-propan-2-ylphenyl)-1,10-phenanthroline (PubChem CID 118927448) has the molecular formula C35H38N2 and a molecular weight of 486.70 g/mol. Its IUPAC name is 4-(2-tert-butyl-6-methylphenyl)-2,9-dimethyl-7-(2-methyl-6-propan-2-ylphenyl)-1,10-phenanthroline.
| Compound Name | 4-(2-tert-butyl-6-methylphenyl)-2,9-dimethyl-7-(2-methyl-6-propan-2-ylphenyl)-1,10-phenanthroline |
|---|---|
| PubChem CID | 118927448 |
| Molecular Formula | C35H38N2 |
| Molecular Weight | 486.70 g/mol |
| Exact Mass | 486.30 |
| IUPAC Name | 4-(2-tert-butyl-6-methylphenyl)-2,9-dimethyl-7-(2-methyl-6-propan-2-ylphenyl)-1,10-phenanthroline |
| SMILES | Cc1cc(-c2c(C)cccc2C(C)C)c2ccc3c(-c4c(C)cccc4C(C)(C)C)cc(C)nc3c2n1 |
| InChI | InChI=1S/C35H38N2/c1-20(2)25-14-10-12-21(3)31(25)28-18-23(5)36-33-26(28)16-17-27-29(19-24(6)37-34(27)33)32-22(4)13-11-15-30(32)35(7,8)9/h10-20H,1-9H3 |
| InChIKey | YAFHLNQSZRNRLN-UHFFFAOYSA-N |
| XLogP | 9.77 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.70 |
| LogP ≤ 5 | 9.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|