C16H22N4O2 — CID 118928201
(1R,2R)-2-amino-1-[[2-(3-propan-2-ylphenoxy)pyrimidin-5-yl]amino]propan-1-ol (PubChem CID 118928201) has the molecular formula C16H22N4O2 and a molecular weight of 302.38 g/mol. Its IUPAC name is (1R,2R)-2-amino-1-[[2-(3-propan-2-ylphenoxy)pyrimidin-5-yl]amino]propan-1-ol.
| Compound Name | (1R,2R)-2-amino-1-[[2-(3-propan-2-ylphenoxy)pyrimidin-5-yl]amino]propan-1-ol |
|---|---|
| PubChem CID | 118928201 |
| Molecular Formula | C16H22N4O2 |
| Molecular Weight | 302.38 g/mol |
| Exact Mass | 302.17 |
| IUPAC Name | (1R,2R)-2-amino-1-[[2-(3-propan-2-ylphenoxy)pyrimidin-5-yl]amino]propan-1-ol |
| SMILES | CC(C)c1cccc(Oc2ncc(N[C@H](O)[C@@H](C)N)cn2)c1 |
| InChI | InChI=1S/C16H22N4O2/c1-10(2)12-5-4-6-14(7-12)22-16-18-8-13(9-19-16)20-15(21)11(3)17/h4-11,15,20-21H,17H2,1-3H3/t11-,15-/m1/s1 |
| InChIKey | GFSUDBRIITZMNO-IAQYHMDHSA-N |
| XLogP | 2.47 |
| TPSA | 93.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.38 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|