C17H13N3 — CID 118933051
10-methyl-9,16,19-triazapentacyclo[9.6.2.02,7.08,19.014,18]nonadeca-1(18),2,4,6,8,10,14,16-octaene (PubChem CID 118933051) has the molecular formula C17H13N3 and a molecular weight of 259.31 g/mol. Its IUPAC name is 10-methyl-9,16,19-triazapentacyclo[9.6.2.02,7.08,19.014,18]nonadeca-1(18),2,4,6,8,10,14,16-octaene.
| Compound Name | 10-methyl-9,16,19-triazapentacyclo[9.6.2.02,7.08,19.014,18]nonadeca-1(18),2,4,6,8,10,14,16-octaene |
|---|---|
| PubChem CID | 118933051 |
| Molecular Formula | C17H13N3 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.11 |
| IUPAC Name | 10-methyl-9,16,19-triazapentacyclo[9.6.2.02,7.08,19.014,18]nonadeca-1(18),2,4,6,8,10,14,16-octaene |
| SMILES | Cc1nc2c3ccccc3c3cncc4c3n2c1CC4 |
| InChI | InChI=1S/C17H13N3/c1-10-15-7-6-11-8-18-9-14-12-4-2-3-5-13(12)17(19-10)20(15)16(11)14/h2-5,8-9H,6-7H2,1H3 |
| InChIKey | VMKJTSMKFUBSHB-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|