C30H41F2N3O7 — CID 118934248
[(2R,3S)-3-[[(2S)-3-(3,5-difluorophenyl)-2-[[(E)-7-methyloct-2-enoyl]amino]propanoyl]amino]-4-methoxy-4-oxobutan-2-yl] 1-acetylpyrrolidine-2-carboxylate (PubChem CID 118934248) has the molecular formula C30H41F2N3O7 and a molecular weight of 593.67 g/mol. Its IUPAC name is [(2R,3S)-3-[[(2S)-3-(3,5-difluorophenyl)-2-[[(E)-7-methyloct-2-enoyl]amino]propanoyl]amino]-4-methoxy-4-oxobutan-2-yl] 1-acetylpyrrolidine-2-carboxylate.
| Compound Name | [(2R,3S)-3-[[(2S)-3-(3,5-difluorophenyl)-2-[[(E)-7-methyloct-2-enoyl]amino]propanoyl]amino]-4-methoxy-4-oxobutan-2-yl] 1-acetylpyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 118934248 |
| Molecular Formula | C30H41F2N3O7 |
| Molecular Weight | 593.67 g/mol |
| Exact Mass | 593.29 |
| IUPAC Name | [(2R,3S)-3-[[(2S)-3-(3,5-difluorophenyl)-2-[[(E)-7-methyloct-2-enoyl]amino]propanoyl]amino]-4-methoxy-4-oxobutan-2-yl] 1-acetylpyrrolidine-2-carboxylate |
| SMILES | COC(=O)[C@@H](NC(=O)[C@H](Cc1cc(F)cc(F)c1)NC(=O)/C=C/CCCC(C)C)[C@@H](C)OC(=O)C1CCCN1C(C)=O |
| InChI | InChI=1S/C30H41F2N3O7/c1-18(2)10-7-6-8-12-26(37)33-24(16-21-14-22(31)17-23(32)15-21)28(38)34-27(30(40)41-5)19(3)42-29(39)25-11-9-13-35(25)20(4)36/h8,12,14-15,17-19,24-25,27H,6-7,9-11,13,16H2,1-5H3,(H,33,37)(H,34,38)/b12-8+/t19-,24+,25?,27+/m1/s1 |
| InChIKey | GMIAKUSDEZNDBJ-BBNPHEHVSA-N |
| XLogP | 2.97 |
| TPSA | 131.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.67 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|