C27H30O9 — CID 118935519
3-[(5R,5aR,8aS,9R)-8-oxo-9-(3,4,5-trimethoxyphenyl)-5a,6,8a,9-tetrahydro-5H-[2]benzofuro[6,5-f][1,3]benzodioxol-5-yl]pentanoic acid (PubChem CID 118935519) has the molecular formula C27H30O9 and a molecular weight of 498.53 g/mol. Its IUPAC name is 3-[(5R,5aR,8aS,9R)-8-oxo-9-(3,4,5-trimethoxyphenyl)-5a,6,8a,9-tetrahydro-5H-[2]benzofuro[6,5-f][1,3]benzodioxol-5-yl]pentanoic acid.
| Compound Name | 3-[(5R,5aR,8aS,9R)-8-oxo-9-(3,4,5-trimethoxyphenyl)-5a,6,8a,9-tetrahydro-5H-[2]benzofuro[6,5-f][1,3]benzodioxol-5-yl]pentanoic acid |
|---|---|
| PubChem CID | 118935519 |
| Molecular Formula | C27H30O9 |
| Molecular Weight | 498.53 g/mol |
| Exact Mass | 498.19 |
| IUPAC Name | 3-[(5R,5aR,8aS,9R)-8-oxo-9-(3,4,5-trimethoxyphenyl)-5a,6,8a,9-tetrahydro-5H-[2]benzofuro[6,5-f][1,3]benzodioxol-5-yl]pentanoic acid |
| SMILES | CCC(CC(=O)O)[C@H]1c2cc3c(cc2[C@@H](c2cc(OC)c(OC)c(OC)c2)[C@@H]2C(=O)OC[C@@H]21)OCO3 |
| InChI | InChI=1S/C27H30O9/c1-5-13(8-22(28)29)23-15-9-18-19(36-12-35-18)10-16(15)24(25-17(23)11-34-27(25)30)14-6-20(31-2)26(33-4)21(7-14)32-3/h6-7,9-10,13,17,23-25H,5,8,11-12H2,1-4H3,(H,28,29)/t13?,17-,23+,24-,25-/m1/s1 |
| InChIKey | TVFPMSLVZSBOJO-AQGVLPCSSA-N |
| XLogP | 3.96 |
| TPSA | 109.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.53 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |