C21H34N2O3 — CID 118936164
tert-butyl 4-(4-amino-3-propan-2-yloxyphenyl)-2,6-dimethylpiperidine-1-carboxylate (PubChem CID 118936164) has the molecular formula C21H34N2O3 and a molecular weight of 362.51 g/mol. Its IUPAC name is tert-butyl 4-(4-amino-3-propan-2-yloxyphenyl)-2,6-dimethylpiperidine-1-carboxylate.
| Compound Name | tert-butyl 4-(4-amino-3-propan-2-yloxyphenyl)-2,6-dimethylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 118936164 |
| Molecular Formula | C21H34N2O3 |
| Molecular Weight | 362.51 g/mol |
| Exact Mass | 362.26 |
| IUPAC Name | tert-butyl 4-(4-amino-3-propan-2-yloxyphenyl)-2,6-dimethylpiperidine-1-carboxylate |
| SMILES | CC(C)Oc1cc(C2CC(C)N(C(=O)OC(C)(C)C)C(C)C2)ccc1N |
| InChI | InChI=1S/C21H34N2O3/c1-13(2)25-19-12-16(8-9-18(19)22)17-10-14(3)23(15(4)11-17)20(24)26-21(5,6)7/h8-9,12-15,17H,10-11,22H2,1-7H3 |
| InChIKey | MSYGBYIVQBDIQM-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.51 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|