C19H17IN4O — CID 118937079
4-[3-iodo-1-[(1S)-1-pyridin-2-ylethyl]indazol-6-yl]-3,5-dimethyl-1,2-oxazole (PubChem CID 118937079) has the molecular formula C19H17IN4O and a molecular weight of 444.28 g/mol. Its IUPAC name is 4-[3-iodo-1-[(1S)-1-pyridin-2-ylethyl]indazol-6-yl]-3,5-dimethyl-1,2-oxazole.
| Compound Name | 4-[3-iodo-1-[(1S)-1-pyridin-2-ylethyl]indazol-6-yl]-3,5-dimethyl-1,2-oxazole |
|---|---|
| PubChem CID | 118937079 |
| Molecular Formula | C19H17IN4O |
| Molecular Weight | 444.28 g/mol |
| Exact Mass | 444.04 |
| IUPAC Name | 4-[3-iodo-1-[(1S)-1-pyridin-2-ylethyl]indazol-6-yl]-3,5-dimethyl-1,2-oxazole |
| SMILES | Cc1noc(C)c1-c1ccc2c(I)nn([C@@H](C)c3ccccn3)c2c1 |
| InChI | InChI=1S/C19H17IN4O/c1-11-18(13(3)25-23-11)14-7-8-15-17(10-14)24(22-19(15)20)12(2)16-6-4-5-9-21-16/h4-10,12H,1-3H3/t12-/m0/s1 |
| InChIKey | DZJQWDUDLYQCNA-LBPRGKRZSA-N |
| XLogP | 4.92 |
| TPSA | 56.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.28 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|