C18H24NO4P — CID 118941466
[[[4-(hydroxymethyl)phenyl]-(4-methoxyphenyl)methyl]-propan-2-ylamino]phosphonous acid (PubChem CID 118941466) has the molecular formula C18H24NO4P and a molecular weight of 349.37 g/mol. Its IUPAC name is [[[4-(hydroxymethyl)phenyl]-(4-methoxyphenyl)methyl]-propan-2-ylamino]phosphonous acid.
| Compound Name | [[[4-(hydroxymethyl)phenyl]-(4-methoxyphenyl)methyl]-propan-2-ylamino]phosphonous acid |
|---|---|
| PubChem CID | 118941466 |
| Molecular Formula | C18H24NO4P |
| Molecular Weight | 349.37 g/mol |
| Exact Mass | 349.14 |
| IUPAC Name | [[[4-(hydroxymethyl)phenyl]-(4-methoxyphenyl)methyl]-propan-2-ylamino]phosphonous acid |
| SMILES | COc1ccc(C(c2ccc(CO)cc2)N(C(C)C)P(O)O)cc1 |
| InChI | InChI=1S/C18H24NO4P/c1-13(2)19(24(21)22)18(15-6-4-14(12-20)5-7-15)16-8-10-17(23-3)11-9-16/h4-11,13,18,20-22H,12H2,1-3H3 |
| InChIKey | AWXDLUQKLDREBX-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 73.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.37 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|