C18H17N2O5- — CID 11894243
2-[[2-[(1S,2S,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]acetyl]amino]benzoate (PubChem CID 11894243) has the molecular formula C18H17N2O5- and a molecular weight of 341.34 g/mol. Its IUPAC name is 2-[[2-[(1S,2S,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]acetyl]amino]benzoate.
| Compound Name | 2-[[2-[(1S,2S,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 11894243 |
| Molecular Formula | C18H17N2O5- |
| Molecular Weight | 341.34 g/mol |
| Exact Mass | 341.11 |
| IUPAC Name | 2-[[2-[(1S,2S,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]acetyl]amino]benzoate |
| SMILES | O=C(CN1C(=O)[C@H]2[C@@H]3CC[C@@H](C3)[C@@H]2C1=O)Nc1ccccc1C(=O)[O-] |
| InChI | InChI=1S/C18H18N2O5/c21-13(19-12-4-2-1-3-11(12)18(24)25)8-20-16(22)14-9-5-6-10(7-9)15(14)17(20)23/h1-4,9-10,14-15H,5-8H2,(H,19,21)(H,24,25)/p-1/t9-,10+,14-,15-/m0/s1 |
| InChIKey | VPVJMOXWDSXDAW-OWLDWWDNSA-M |
| XLogP | 0.02 |
| TPSA | 106.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.34 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|