C17H16IN3OS — CID 118944790
1-[3-(benzylcarbamoyl)imidazo[1,2-a]pyridin-2-yl]ethyl thiohypoiodite (PubChem CID 118944790) has the molecular formula C17H16IN3OS and a molecular weight of 437.31 g/mol. Its IUPAC name is 1-[3-(benzylcarbamoyl)imidazo[1,2-a]pyridin-2-yl]ethyl thiohypoiodite.
| Compound Name | 1-[3-(benzylcarbamoyl)imidazo[1,2-a]pyridin-2-yl]ethyl thiohypoiodite |
|---|---|
| PubChem CID | 118944790 |
| Molecular Formula | C17H16IN3OS |
| Molecular Weight | 437.31 g/mol |
| Exact Mass | 437.01 |
| IUPAC Name | 1-[3-(benzylcarbamoyl)imidazo[1,2-a]pyridin-2-yl]ethyl thiohypoiodite |
| SMILES | CC(SI)c1nc2ccccn2c1C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C17H16IN3OS/c1-12(23-18)15-16(21-10-6-5-9-14(21)20-15)17(22)19-11-13-7-3-2-4-8-13/h2-10,12H,11H2,1H3,(H,19,22) |
| InChIKey | RXTYGROHMSFLPT-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 46.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.31 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|