C24H18N6O4 — CID 13167972
4-N,10-N-dibenzyl-2,8-dioxo-1,5,7,11-tetrazatricyclo[7.3.0.03,7]dodeca-3,5,9,11-tetraene-4,10-dicarboxamide (PubChem CID 13167972) has the molecular formula C24H18N6O4 and a molecular weight of 454.45 g/mol. Its IUPAC name is 4-N,10-N-dibenzyl-2,8-dioxo-1,5,7,11-tetrazatricyclo[7.3.0.03,7]dodeca-3,5,9,11-tetraene-4,10-dicarboxamide.
| Compound Name | 4-N,10-N-dibenzyl-2,8-dioxo-1,5,7,11-tetrazatricyclo[7.3.0.03,7]dodeca-3,5,9,11-tetraene-4,10-dicarboxamide |
|---|---|
| PubChem CID | 13167972 |
| Molecular Formula | C24H18N6O4 |
| Molecular Weight | 454.45 g/mol |
| Exact Mass | 454.14 |
| IUPAC Name | 4-N,10-N-dibenzyl-2,8-dioxo-1,5,7,11-tetrazatricyclo[7.3.0.03,7]dodeca-3,5,9,11-tetraene-4,10-dicarboxamide |
| SMILES | O=C(NCc1ccccc1)c1ncn2c(=O)c3c(C(=O)NCc4ccccc4)ncn3c(=O)c12 |
| InChI | InChI=1S/C24H18N6O4/c31-21(25-11-15-7-3-1-4-8-15)17-19-23(33)30-14-28-18(20(30)24(34)29(19)13-27-17)22(32)26-12-16-9-5-2-6-10-16/h1-10,13-14H,11-12H2,(H,25,31)(H,26,32) |
| InChIKey | MYXPADWIELHKDA-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 126.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.45 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |