C25H28IN5O4 — CID 118945317
amino (2S)-3-[4-[4-(2-cyclopropylethyl)anilino]-3-[(4-methylphenyl)methyl]-2,6-dioxo-1,3,5-triazin-1-yl]-2-iodopropanoate (PubChem CID 118945317) has the molecular formula C25H28IN5O4 and a molecular weight of 589.43 g/mol. Its IUPAC name is amino (2S)-3-[4-[4-(2-cyclopropylethyl)anilino]-3-[(4-methylphenyl)methyl]-2,6-dioxo-1,3,5-triazin-1-yl]-2-iodopropanoate.
| Compound Name | amino (2S)-3-[4-[4-(2-cyclopropylethyl)anilino]-3-[(4-methylphenyl)methyl]-2,6-dioxo-1,3,5-triazin-1-yl]-2-iodopropanoate |
|---|---|
| PubChem CID | 118945317 |
| Molecular Formula | C25H28IN5O4 |
| Molecular Weight | 589.43 g/mol |
| Exact Mass | 589.12 |
| IUPAC Name | amino (2S)-3-[4-[4-(2-cyclopropylethyl)anilino]-3-[(4-methylphenyl)methyl]-2,6-dioxo-1,3,5-triazin-1-yl]-2-iodopropanoate |
| SMILES | Cc1ccc(Cn2c(Nc3ccc(CCC4CC4)cc3)nc(=O)n(C[C@H](I)C(=O)ON)c2=O)cc1 |
| InChI | InChI=1S/C25H28IN5O4/c1-16-2-4-19(5-3-16)14-30-23(28-20-12-10-18(11-13-20)9-8-17-6-7-17)29-24(33)31(25(30)34)15-21(26)22(32)35-27/h2-5,10-13,17,21H,6-9,14-15,27H2,1H3,(H,28,29,33)/t21-/m0/s1 |
| InChIKey | VZPCCCVWXYWCNB-NRFANRHFSA-N |
| XLogP | 3.07 |
| TPSA | 121.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.43 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|