C26H31N5O4 — CID 130278222
(2S)-2-methyl-3-[3-[(4-methylphenyl)methyl]-2,6-dioxo-4-(4-piperidin-1-ylanilino)-1,3,5-triazin-1-yl]propanoic acid (PubChem CID 130278222) has the molecular formula C26H31N5O4 and a molecular weight of 477.57 g/mol. Its IUPAC name is (2S)-2-methyl-3-[3-[(4-methylphenyl)methyl]-2,6-dioxo-4-(4-piperidin-1-ylanilino)-1,3,5-triazin-1-yl]propanoic acid.
| Compound Name | (2S)-2-methyl-3-[3-[(4-methylphenyl)methyl]-2,6-dioxo-4-(4-piperidin-1-ylanilino)-1,3,5-triazin-1-yl]propanoic acid |
|---|---|
| PubChem CID | 130278222 |
| Molecular Formula | C26H31N5O4 |
| Molecular Weight | 477.57 g/mol |
| Exact Mass | 477.24 |
| IUPAC Name | (2S)-2-methyl-3-[3-[(4-methylphenyl)methyl]-2,6-dioxo-4-(4-piperidin-1-ylanilino)-1,3,5-triazin-1-yl]propanoic acid |
| SMILES | Cc1ccc(Cn2c(Nc3ccc(N4CCCCC4)cc3)nc(=O)n(C[C@H](C)C(=O)O)c2=O)cc1 |
| InChI | InChI=1S/C26H31N5O4/c1-18-6-8-20(9-7-18)17-30-24(28-25(34)31(26(30)35)16-19(2)23(32)33)27-21-10-12-22(13-11-21)29-14-4-3-5-15-29/h6-13,19H,3-5,14-17H2,1-2H3,(H,32,33)(H,27,28,34)/t19-/m0/s1 |
| InChIKey | OMFCSFNKAPMHHO-IBGZPJMESA-N |
| XLogP | 3.22 |
| TPSA | 109.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.57 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|