C26H25ClF6N4O6 — CID 121295546
(2S)-3-[4-[3,4-bis[[(2R)-1,1,1-trifluoropropan-2-yl]oxy]anilino]-3-[(4-chlorophenyl)methyl]-2,6-dioxo-1,3,5-triazin-1-yl]-2-methylpropanoic acid (PubChem CID 121295546) has the molecular formula C26H25ClF6N4O6 and a molecular weight of 638.95 g/mol. Its IUPAC name is (2S)-3-[4-[3,4-bis[[(2R)-1,1,1-trifluoropropan-2-yl]oxy]anilino]-3-[(4-chlorophenyl)methyl]-2,6-dioxo-1,3,5-triazin-1-yl]-2-methylpropanoic acid.
| Compound Name | (2S)-3-[4-[3,4-bis[[(2R)-1,1,1-trifluoropropan-2-yl]oxy]anilino]-3-[(4-chlorophenyl)methyl]-2,6-dioxo-1,3,5-triazin-1-yl]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 121295546 |
| Molecular Formula | C26H25ClF6N4O6 |
| Molecular Weight | 638.95 g/mol |
| Exact Mass | 638.14 |
| IUPAC Name | (2S)-3-[4-[3,4-bis[[(2R)-1,1,1-trifluoropropan-2-yl]oxy]anilino]-3-[(4-chlorophenyl)methyl]-2,6-dioxo-1,3,5-triazin-1-yl]-2-methylpropanoic acid |
| SMILES | C[C@@H](Cn1c(=O)nc(Nc2ccc(O[C@H](C)C(F)(F)F)c(O[C@H](C)C(F)(F)F)c2)n(Cc2ccc(Cl)cc2)c1=O)C(=O)O |
| InChI | InChI=1S/C26H25ClF6N4O6/c1-13(21(38)39)11-37-23(40)35-22(36(24(37)41)12-16-4-6-17(27)7-5-16)34-18-8-9-19(42-14(2)25(28,29)30)20(10-18)43-15(3)26(31,32)33/h4-10,13-15H,11-12H2,1-3H3,(H,38,39)(H,34,35,40)/t13-,14+,15+/m0/s1 |
| InChIKey | ICQBCSSKNIFTJJ-RRFJBIMHSA-N |
| XLogP | 5.23 |
| TPSA | 124.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.95 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |