C23H26ClFN4O4 — CID 58578887
1-[(4-chlorophenyl)methyl]-6-(3-fluoro-4-propan-2-yloxyanilino)-3-(4-hydroxybutyl)-1,3,5-triazine-2,4-dione (PubChem CID 58578887) has the molecular formula C23H26ClFN4O4 and a molecular weight of 476.94 g/mol. Its IUPAC name is 1-[(4-chlorophenyl)methyl]-6-(3-fluoro-4-propan-2-yloxyanilino)-3-(4-hydroxybutyl)-1,3,5-triazine-2,4-dione.
| Compound Name | 1-[(4-chlorophenyl)methyl]-6-(3-fluoro-4-propan-2-yloxyanilino)-3-(4-hydroxybutyl)-1,3,5-triazine-2,4-dione |
|---|---|
| PubChem CID | 58578887 |
| Molecular Formula | C23H26ClFN4O4 |
| Molecular Weight | 476.94 g/mol |
| Exact Mass | 476.16 |
| IUPAC Name | 1-[(4-chlorophenyl)methyl]-6-(3-fluoro-4-propan-2-yloxyanilino)-3-(4-hydroxybutyl)-1,3,5-triazine-2,4-dione |
| SMILES | CC(C)Oc1ccc(Nc2nc(=O)n(CCCCO)c(=O)n2Cc2ccc(Cl)cc2)cc1F |
| InChI | InChI=1S/C23H26ClFN4O4/c1-15(2)33-20-10-9-18(13-19(20)25)26-21-27-22(31)28(11-3-4-12-30)23(32)29(21)14-16-5-7-17(24)8-6-16/h5-10,13,15,30H,3-4,11-12,14H2,1-2H3,(H,26,27,31) |
| InChIKey | WIVQLHRBUYZELM-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 98.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.94 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|