C32H36ClN5O — CID 118946026
N-[2-[(3-chlorophenyl)methyl]butylidene]-2-[3-methyl-4-[3-[(Z)-pent-2-en-4-ynimidoyl]benzoyl]piperazin-1-yl]but-2-enimidamide (PubChem CID 118946026) has the molecular formula C32H36ClN5O and a molecular weight of 542.13 g/mol. Its IUPAC name is N-[2-[(3-chlorophenyl)methyl]butylidene]-2-[3-methyl-4-[3-[(Z)-pent-2-en-4-ynimidoyl]benzoyl]piperazin-1-yl]but-2-enimidamide.
| Compound Name | N-[2-[(3-chlorophenyl)methyl]butylidene]-2-[3-methyl-4-[3-[(Z)-pent-2-en-4-ynimidoyl]benzoyl]piperazin-1-yl]but-2-enimidamide |
|---|---|
| PubChem CID | 118946026 |
| Molecular Formula | C32H36ClN5O |
| Molecular Weight | 542.13 g/mol |
| Exact Mass | 541.26 |
| IUPAC Name | N-[2-[(3-chlorophenyl)methyl]butylidene]-2-[3-methyl-4-[3-[(Z)-pent-2-en-4-ynimidoyl]benzoyl]piperazin-1-yl]but-2-enimidamide |
| SMILES | [H]/N=C(\N=C\C(CC)Cc1cccc(Cl)c1)C(=CC)N1CCN(C(=O)c2cccc(C(/C=C\C#C)=N/[H])c2)C(C)C1 |
| InChI | InChI=1S/C32H36ClN5O/c1-5-8-15-29(34)26-12-10-13-27(20-26)32(39)38-17-16-37(22-23(38)4)30(7-3)31(35)36-21-24(6-2)18-25-11-9-14-28(33)19-25/h1,7-15,19-21,23-24,34-35H,6,16-18,22H2,2-4H3/b15-8-,30-7?,34-29+,35-31-,36-21+ |
| InChIKey | UVWIGXUNDZLGLP-MZUPTHCFSA-N |
| XLogP | 6.26 |
| TPSA | 83.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.13 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|