C29H32ClIN4O2 — CID 118946100
N-[2-[(3-chlorophenyl)methyl]butylidene]-2-[4-(5-iodo-3-methyl-1-benzofuran-2-carbonyl)-3-methylpiperazin-1-yl]prop-2-enimidamide (PubChem CID 118946100) has the molecular formula C29H32ClIN4O2 and a molecular weight of 630.96 g/mol. Its IUPAC name is N-[2-[(3-chlorophenyl)methyl]butylidene]-2-[4-(5-iodo-3-methyl-1-benzofuran-2-carbonyl)-3-methylpiperazin-1-yl]prop-2-enimidamide.
| Compound Name | N-[2-[(3-chlorophenyl)methyl]butylidene]-2-[4-(5-iodo-3-methyl-1-benzofuran-2-carbonyl)-3-methylpiperazin-1-yl]prop-2-enimidamide |
|---|---|
| PubChem CID | 118946100 |
| Molecular Formula | C29H32ClIN4O2 |
| Molecular Weight | 630.96 g/mol |
| Exact Mass | 630.13 |
| IUPAC Name | N-[2-[(3-chlorophenyl)methyl]butylidene]-2-[4-(5-iodo-3-methyl-1-benzofuran-2-carbonyl)-3-methylpiperazin-1-yl]prop-2-enimidamide |
| SMILES | [H]/N=C(\N=C\C(CC)Cc1cccc(Cl)c1)C(=C)N1CCN(C(=O)c2oc3ccc(I)cc3c2C)C(C)C1 |
| InChI | InChI=1S/C29H32ClIN4O2/c1-5-21(13-22-7-6-8-23(30)14-22)16-33-28(32)20(4)34-11-12-35(18(2)17-34)29(36)27-19(3)25-15-24(31)9-10-26(25)37-27/h6-10,14-16,18,21,32H,4-5,11-13,17H2,1-3H3/b32-28-,33-16+ |
| InChIKey | PCFOADLMOCLXKS-XWMKRRHDSA-N |
| XLogP | 6.98 |
| TPSA | 72.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.96 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|