C19H24ClN3O4 — CID 143151156
[4-[1-amino-2-(3-chlorophenyl)ethyl]piperidin-1-yl]-(5-methyl-1,2-oxazol-3-yl)methanone;formic acid (PubChem CID 143151156) has the molecular formula C19H24ClN3O4 and a molecular weight of 393.87 g/mol. Its IUPAC name is [4-[1-amino-2-(3-chlorophenyl)ethyl]piperidin-1-yl]-(5-methyl-1,2-oxazol-3-yl)methanone;formic acid.
| Compound Name | [4-[1-amino-2-(3-chlorophenyl)ethyl]piperidin-1-yl]-(5-methyl-1,2-oxazol-3-yl)methanone;formic acid |
|---|---|
| PubChem CID | 143151156 |
| Molecular Formula | C19H24ClN3O4 |
| Molecular Weight | 393.87 g/mol |
| Exact Mass | 393.15 |
| IUPAC Name | [4-[1-amino-2-(3-chlorophenyl)ethyl]piperidin-1-yl]-(5-methyl-1,2-oxazol-3-yl)methanone;formic acid |
| SMILES | Cc1cc(C(=O)N2CCC(C(N)Cc3cccc(Cl)c3)CC2)no1.O=CO |
| InChI | InChI=1S/C18H22ClN3O2.CH2O2/c1-12-9-17(21-24-12)18(23)22-7-5-14(6-8-22)16(20)11-13-3-2-4-15(19)10-13;2-1-3/h2-4,9-10,14,16H,5-8,11,20H2,1H3;1H,(H,2,3) |
| InChIKey | RZIMXMOBXGIMJJ-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 109.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.87 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|