C19H25ClN4O3 — CID 143151185
[4-[1-amino-2-(3-chlorophenyl)ethyl]piperidin-1-yl]-(3-methylimidazol-4-yl)methanone;formic acid (PubChem CID 143151185) has the molecular formula C19H25ClN4O3 and a molecular weight of 392.89 g/mol. Its IUPAC name is [4-[1-amino-2-(3-chlorophenyl)ethyl]piperidin-1-yl]-(3-methylimidazol-4-yl)methanone;formic acid.
| Compound Name | [4-[1-amino-2-(3-chlorophenyl)ethyl]piperidin-1-yl]-(3-methylimidazol-4-yl)methanone;formic acid |
|---|---|
| PubChem CID | 143151185 |
| Molecular Formula | C19H25ClN4O3 |
| Molecular Weight | 392.89 g/mol |
| Exact Mass | 392.16 |
| IUPAC Name | [4-[1-amino-2-(3-chlorophenyl)ethyl]piperidin-1-yl]-(3-methylimidazol-4-yl)methanone;formic acid |
| SMILES | Cn1cncc1C(=O)N1CCC(C(N)Cc2cccc(Cl)c2)CC1.O=CO |
| InChI | InChI=1S/C18H23ClN4O.CH2O2/c1-22-12-21-11-17(22)18(24)23-7-5-14(6-8-23)16(20)10-13-3-2-4-15(19)9-13;2-1-3/h2-4,9,11-12,14,16H,5-8,10,20H2,1H3;1H,(H,2,3) |
| InChIKey | PECCAGBYTONEJM-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 101.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.89 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|