C21H27ClN4O — CID 143151214
[3-[1-amino-2-(3-chlorophenyl)ethyl]piperidin-1-yl]-[3-[amino(methyl)amino]phenyl]methanone (PubChem CID 143151214) has the molecular formula C21H27ClN4O and a molecular weight of 386.93 g/mol. Its IUPAC name is [3-[1-amino-2-(3-chlorophenyl)ethyl]piperidin-1-yl]-[3-[amino(methyl)amino]phenyl]methanone.
| Compound Name | [3-[1-amino-2-(3-chlorophenyl)ethyl]piperidin-1-yl]-[3-[amino(methyl)amino]phenyl]methanone |
|---|---|
| PubChem CID | 143151214 |
| Molecular Formula | C21H27ClN4O |
| Molecular Weight | 386.93 g/mol |
| Exact Mass | 386.19 |
| IUPAC Name | [3-[1-amino-2-(3-chlorophenyl)ethyl]piperidin-1-yl]-[3-[amino(methyl)amino]phenyl]methanone |
| SMILES | CN(N)c1cccc(C(=O)N2CCCC(C(N)Cc3cccc(Cl)c3)C2)c1 |
| InChI | InChI=1S/C21H27ClN4O/c1-25(24)19-9-3-6-16(13-19)21(27)26-10-4-7-17(14-26)20(23)12-15-5-2-8-18(22)11-15/h2-3,5-6,8-9,11,13,17,20H,4,7,10,12,14,23-24H2,1H3 |
| InChIKey | LEXGGJDHHGWSGU-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 75.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.93 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|