C19H23ClN4O3 — CID 161030280
[4-[1-amino-2-(3-chlorophenyl)ethyl]piperidin-1-yl]-pyridazin-4-ylmethanone;formic acid (PubChem CID 161030280) has the molecular formula C19H23ClN4O3 and a molecular weight of 390.87 g/mol. Its IUPAC name is [4-[1-amino-2-(3-chlorophenyl)ethyl]piperidin-1-yl]-pyridazin-4-ylmethanone;formic acid.
| Compound Name | [4-[1-amino-2-(3-chlorophenyl)ethyl]piperidin-1-yl]-pyridazin-4-ylmethanone;formic acid |
|---|---|
| PubChem CID | 161030280 |
| Molecular Formula | C19H23ClN4O3 |
| Molecular Weight | 390.87 g/mol |
| Exact Mass | 390.15 |
| IUPAC Name | [4-[1-amino-2-(3-chlorophenyl)ethyl]piperidin-1-yl]-pyridazin-4-ylmethanone;formic acid |
| SMILES | NC(Cc1cccc(Cl)c1)C1CCN(C(=O)c2ccnnc2)CC1.O=CO |
| InChI | InChI=1S/C18H21ClN4O.CH2O2/c19-16-3-1-2-13(10-16)11-17(20)14-5-8-23(9-6-14)18(24)15-4-7-21-22-12-15;2-1-3/h1-4,7,10,12,14,17H,5-6,8-9,11,20H2;1H,(H,2,3) |
| InChIKey | TZNFAVCHBIXVTC-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 109.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.87 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|