C20H18N6O3S — CID 118950058
7-methyl-8-(4-methylsulfonylphenyl)-N-(5-methyltetrazol-5-yl)quinoline-6-carboxamide (PubChem CID 118950058) has the molecular formula C20H18N6O3S and a molecular weight of 422.47 g/mol. Its IUPAC name is 7-methyl-8-(4-methylsulfonylphenyl)-N-(5-methyltetrazol-5-yl)quinoline-6-carboxamide.
| Compound Name | 7-methyl-8-(4-methylsulfonylphenyl)-N-(5-methyltetrazol-5-yl)quinoline-6-carboxamide |
|---|---|
| PubChem CID | 118950058 |
| Molecular Formula | C20H18N6O3S |
| Molecular Weight | 422.47 g/mol |
| Exact Mass | 422.12 |
| IUPAC Name | 7-methyl-8-(4-methylsulfonylphenyl)-N-(5-methyltetrazol-5-yl)quinoline-6-carboxamide |
| SMILES | Cc1c(C(=O)NC2(C)N=NN=N2)cc2cccnc2c1-c1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C20H18N6O3S/c1-12-16(19(27)22-20(2)23-25-26-24-20)11-14-5-4-10-21-18(14)17(12)13-6-8-15(9-7-13)30(3,28)29/h4-11H,1-3H3,(H,22,27) |
| InChIKey | VYJVKWIZKWVJHF-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 125.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.47 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |