C17H12ClNO2 — CID 150999301
8-(4-chlorophenyl)-6-methylquinoline-7-carboxylic acid (PubChem CID 150999301) has the molecular formula C17H12ClNO2 and a molecular weight of 297.74 g/mol. Its IUPAC name is 8-(4-chlorophenyl)-6-methylquinoline-7-carboxylic acid.
| Compound Name | 8-(4-chlorophenyl)-6-methylquinoline-7-carboxylic acid |
|---|---|
| PubChem CID | 150999301 |
| Molecular Formula | C17H12ClNO2 |
| Molecular Weight | 297.74 g/mol |
| Exact Mass | 297.06 |
| IUPAC Name | 8-(4-chlorophenyl)-6-methylquinoline-7-carboxylic acid |
| SMILES | Cc1cc2cccnc2c(-c2ccc(Cl)cc2)c1C(=O)O |
| InChI | InChI=1S/C17H12ClNO2/c1-10-9-12-3-2-8-19-16(12)15(14(10)17(20)21)11-4-6-13(18)7-5-11/h2-9H,1H3,(H,20,21) |
| InChIKey | LTTQBKWUBUSUMD-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.74 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |