C19H12Cl2O3 — CID 141324517
2-[7-chloro-1-(4-chlorophenyl)-3-methylnaphthalen-2-yl]-2-oxoacetic acid (PubChem CID 141324517) has the molecular formula C19H12Cl2O3 and a molecular weight of 359.21 g/mol. Its IUPAC name is 2-[7-chloro-1-(4-chlorophenyl)-3-methylnaphthalen-2-yl]-2-oxoacetic acid.
| Compound Name | 2-[7-chloro-1-(4-chlorophenyl)-3-methylnaphthalen-2-yl]-2-oxoacetic acid |
|---|---|
| PubChem CID | 141324517 |
| Molecular Formula | C19H12Cl2O3 |
| Molecular Weight | 359.21 g/mol |
| Exact Mass | 358.02 |
| IUPAC Name | 2-[7-chloro-1-(4-chlorophenyl)-3-methylnaphthalen-2-yl]-2-oxoacetic acid |
| SMILES | Cc1cc2ccc(Cl)cc2c(-c2ccc(Cl)cc2)c1C(=O)C(=O)O |
| InChI | InChI=1S/C19H12Cl2O3/c1-10-8-12-4-7-14(21)9-15(12)17(16(10)18(22)19(23)24)11-2-5-13(20)6-3-11/h2-9H,1H3,(H,23,24) |
| InChIKey | KFIKVAPZDNHLEI-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.21 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|