C18H15Cl — CID 123950118
1-(4-chlorophenyl)-2,3-dimethylnaphthalene (PubChem CID 123950118) has the molecular formula C18H15Cl and a molecular weight of 266.77 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-2,3-dimethylnaphthalene.
| Compound Name | 1-(4-chlorophenyl)-2,3-dimethylnaphthalene |
|---|---|
| PubChem CID | 123950118 |
| Molecular Formula | C18H15Cl |
| Molecular Weight | 266.77 g/mol |
| Exact Mass | 266.09 |
| IUPAC Name | 1-(4-chlorophenyl)-2,3-dimethylnaphthalene |
| SMILES | Cc1cc2ccccc2c(-c2ccc(Cl)cc2)c1C |
| InChI | InChI=1S/C18H15Cl/c1-12-11-15-5-3-4-6-17(15)18(13(12)2)14-7-9-16(19)10-8-14/h3-11H,1-2H3 |
| InChIKey | QNGBBTRSRKSCHD-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.77 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |