C27H25ClO3 — CID 67126190
2-[1-(4-chlorophenyl)-7-[2-(1-hydroxycyclohexyl)ethynyl]-3-methylnaphthalen-2-yl]acetic acid (PubChem CID 67126190) has the molecular formula C27H25ClO3 and a molecular weight of 432.95 g/mol. Its IUPAC name is 2-[1-(4-chlorophenyl)-7-[2-(1-hydroxycyclohexyl)ethynyl]-3-methylnaphthalen-2-yl]acetic acid.
| Compound Name | 2-[1-(4-chlorophenyl)-7-[2-(1-hydroxycyclohexyl)ethynyl]-3-methylnaphthalen-2-yl]acetic acid |
|---|---|
| PubChem CID | 67126190 |
| Molecular Formula | C27H25ClO3 |
| Molecular Weight | 432.95 g/mol |
| Exact Mass | 432.15 |
| IUPAC Name | 2-[1-(4-chlorophenyl)-7-[2-(1-hydroxycyclohexyl)ethynyl]-3-methylnaphthalen-2-yl]acetic acid |
| SMILES | Cc1cc2ccc(C#CC3(O)CCCCC3)cc2c(-c2ccc(Cl)cc2)c1CC(=O)O |
| InChI | InChI=1S/C27H25ClO3/c1-18-15-21-6-5-19(11-14-27(31)12-3-2-4-13-27)16-24(21)26(23(18)17-25(29)30)20-7-9-22(28)10-8-20/h5-10,15-16,31H,2-4,12-13,17H2,1H3,(H,29,30) |
| InChIKey | BDAIFTPVVDDDMY-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.95 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|