C29H29F3N8S2 — CID 118950457
1-[2-(2-amino-1,3-thiazol-4-yl)ethyl]-4-methyl-5-[[4-[[6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl]amino]piperidin-1-yl]methyl]indole-2-carbonitrile (PubChem CID 118950457) has the molecular formula C29H29F3N8S2 and a molecular weight of 610.74 g/mol. Its IUPAC name is 1-[2-(2-amino-1,3-thiazol-4-yl)ethyl]-4-methyl-5-[[4-[[6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl]amino]piperidin-1-yl]methyl]indole-2-carbonitrile.
| Compound Name | 1-[2-(2-amino-1,3-thiazol-4-yl)ethyl]-4-methyl-5-[[4-[[6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl]amino]piperidin-1-yl]methyl]indole-2-carbonitrile |
|---|---|
| PubChem CID | 118950457 |
| Molecular Formula | C29H29F3N8S2 |
| Molecular Weight | 610.74 g/mol |
| Exact Mass | 610.19 |
| IUPAC Name | 1-[2-(2-amino-1,3-thiazol-4-yl)ethyl]-4-methyl-5-[[4-[[6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl]amino]piperidin-1-yl]methyl]indole-2-carbonitrile |
| SMILES | Cc1c(CN2CCC(Nc3ncnc4sc(CC(F)(F)F)cc34)CC2)ccc2c1cc(C#N)n2CCc1csc(N)n1 |
| InChI | InChI=1S/C29H29F3N8S2/c1-17-18(2-3-25-23(17)10-21(13-33)40(25)9-6-20-15-41-28(34)38-20)14-39-7-4-19(5-8-39)37-26-24-11-22(12-29(30,31)32)42-27(24)36-16-35-26/h2-3,10-11,15-16,19H,4-9,12,14H2,1H3,(H2,34,38)(H,35,36,37) |
| InChIKey | TVLSSEDQLWXDFQ-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 108.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.74 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |