C30H34F3N7O2S2 — CID 118888674
1-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-4-methyl-5-[[4-[[6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl]amino]piperidin-1-yl]methyl]indole-2-carbonitrile (PubChem CID 118888674) has the molecular formula C30H34F3N7O2S2 and a molecular weight of 645.78 g/mol. Its IUPAC name is 1-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-4-methyl-5-[[4-[[6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl]amino]piperidin-1-yl]methyl]indole-2-carbonitrile.
| Compound Name | 1-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-4-methyl-5-[[4-[[6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl]amino]piperidin-1-yl]methyl]indole-2-carbonitrile |
|---|---|
| PubChem CID | 118888674 |
| Molecular Formula | C30H34F3N7O2S2 |
| Molecular Weight | 645.78 g/mol |
| Exact Mass | 645.22 |
| IUPAC Name | 1-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-4-methyl-5-[[4-[[6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl]amino]piperidin-1-yl]methyl]indole-2-carbonitrile |
| SMILES | Cc1c(CN2CCC(Nc3ncnc4sc(CC(F)(F)F)cc34)CC2)ccc2c1cc(C#N)n2CCN1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C30H34F3N7O2S2/c1-20-21(2-3-27-25(20)14-23(17-34)40(27)9-8-38-10-12-44(41,42)13-11-38)18-39-6-4-22(5-7-39)37-28-26-15-24(16-30(31,32)33)43-29(26)36-19-35-28/h2-3,14-15,19,22H,4-13,16,18H2,1H3,(H,35,36,37) |
| InChIKey | QMTHSWMXEGFYHJ-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 107.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.78 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |