C16H13FN2O4 — CID 118951448
5-ethyl-6-(5-fluoro-1H-indol-6-yl)-4-hydroxy-2-oxo-1H-pyridine-3-carboxylic acid (PubChem CID 118951448) has the molecular formula C16H13FN2O4 and a molecular weight of 316.29 g/mol. Its IUPAC name is 5-ethyl-6-(5-fluoro-1H-indol-6-yl)-4-hydroxy-2-oxo-1H-pyridine-3-carboxylic acid.
| Compound Name | 5-ethyl-6-(5-fluoro-1H-indol-6-yl)-4-hydroxy-2-oxo-1H-pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 118951448 |
| Molecular Formula | C16H13FN2O4 |
| Molecular Weight | 316.29 g/mol |
| Exact Mass | 316.09 |
| IUPAC Name | 5-ethyl-6-(5-fluoro-1H-indol-6-yl)-4-hydroxy-2-oxo-1H-pyridine-3-carboxylic acid |
| SMILES | CCc1c(-c2cc3[nH]ccc3cc2F)[nH]c(=O)c(C(=O)O)c1O |
| InChI | InChI=1S/C16H13FN2O4/c1-2-8-13(19-15(21)12(14(8)20)16(22)23)9-6-11-7(3-4-18-11)5-10(9)17/h3-6,18H,2H2,1H3,(H,22,23)(H2,19,20,21) |
| InChIKey | HGPDBQXOTULTMU-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 106.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.29 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |