C23H25FO3 — CID 118951597
methyl 5-[4-(2-fluoro-5-propan-2-yloxyphenyl)phenyl]spiro[2.3]hexane-2-carboxylate (PubChem CID 118951597) has the molecular formula C23H25FO3 and a molecular weight of 368.45 g/mol. Its IUPAC name is methyl 5-[4-(2-fluoro-5-propan-2-yloxyphenyl)phenyl]spiro[2.3]hexane-2-carboxylate.
| Compound Name | methyl 5-[4-(2-fluoro-5-propan-2-yloxyphenyl)phenyl]spiro[2.3]hexane-2-carboxylate |
|---|---|
| PubChem CID | 118951597 |
| Molecular Formula | C23H25FO3 |
| Molecular Weight | 368.45 g/mol |
| Exact Mass | 368.18 |
| IUPAC Name | methyl 5-[4-(2-fluoro-5-propan-2-yloxyphenyl)phenyl]spiro[2.3]hexane-2-carboxylate |
| SMILES | COC(=O)C1CC12CC(c1ccc(-c3cc(OC(C)C)ccc3F)cc1)C2 |
| InChI | InChI=1S/C23H25FO3/c1-14(2)27-18-8-9-21(24)19(10-18)16-6-4-15(5-7-16)17-11-23(12-17)13-20(23)22(25)26-3/h4-10,14,17,20H,11-13H2,1-3H3 |
| InChIKey | OIMRLFZRTYZMMF-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.45 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |