C22H25FNO2+ — CID 145039193
[2-[3-[[4-(2-fluoro-5-propan-2-yloxyphenyl)phenyl]methyl]cyclobutyl]-2-oxoethylidene]azanium (PubChem CID 145039193) has the molecular formula C22H25FNO2+ and a molecular weight of 354.45 g/mol. Its IUPAC name is [2-[3-[[4-(2-fluoro-5-propan-2-yloxyphenyl)phenyl]methyl]cyclobutyl]-2-oxoethylidene]azanium.
| Compound Name | [2-[3-[[4-(2-fluoro-5-propan-2-yloxyphenyl)phenyl]methyl]cyclobutyl]-2-oxoethylidene]azanium |
|---|---|
| PubChem CID | 145039193 |
| Molecular Formula | C22H25FNO2+ |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.19 |
| IUPAC Name | [2-[3-[[4-(2-fluoro-5-propan-2-yloxyphenyl)phenyl]methyl]cyclobutyl]-2-oxoethylidene]azanium |
| SMILES | CC(C)Oc1ccc(F)c(-c2ccc(CC3CC(C(=O)C=[NH2+])C3)cc2)c1 |
| InChI | InChI=1S/C22H24FNO2/c1-14(2)26-19-7-8-21(23)20(12-19)17-5-3-15(4-6-17)9-16-10-18(11-16)22(25)13-24/h3-8,12-14,16,18,24H,9-11H2,1-2H3/p+1 |
| InChIKey | MSLIAGDYPRXTMR-UHFFFAOYSA-O |
| XLogP | 3.25 |
| TPSA | 51.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|