About butane;lanthanum(3+);phosphate
butane;lanthanum(3+);phosphate (PubChem CID 118953489) has the molecular formula C4H10LaO4P
and a molecular weight of 292.00 g/mol. Its IUPAC name is butane;lanthanum(3+);phosphate.
Molecular Properties
| Compound Name | butane;lanthanum(3+);phosphate |
| PubChem CID | 118953489 |
| Molecular Formula | C4H10LaO4P |
| Molecular Weight | 292.00 g/mol |
| Exact Mass | 291.94 |
| IUPAC Name | butane;lanthanum(3+);phosphate |
| SMILES | CCCC.O=P([O-])([O-])[O-].[La+3] |
| InChI | InChI=1S/C4H10.La.H3O4P/c1-3-4-2;;1-5(2,3)4/h3-4H2,1-2H3;;(H3,1,2,3,4)/q;+3;/p-3 |
| InChIKey | IMDVWYKYAYCGKE-UHFFFAOYSA-K |
| XLogP | -1.02 |
| TPSA | 86.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.00 |
| LogP ≤ 5 | -1.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze butane;lanthanum(3+);phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butane;lanthanum(3+);phosphate?
The IUPAC name of butane;lanthanum(3+);phosphate (CID 118953489) is butane;lanthanum(3+);phosphate.
What is the SMILES notation for butane;lanthanum(3+);phosphate?
The canonical SMILES for butane;lanthanum(3+);phosphate is CCCC.O=P([O-])([O-])[O-].[La+3].
What is the InChIKey of butane;lanthanum(3+);phosphate?
The InChIKey is IMDVWYKYAYCGKE-UHFFFAOYSA-K. The full InChI is InChI=1S/C4H10.La.H3O4P/c1-3-4-2;;1-5(2,3)4/h3-4H2,1-2H3;;(H3,1,2,3,4)/q;+3;/p-3.
What are the key properties of butane;lanthanum(3+);phosphate?
butane;lanthanum(3+);phosphate has a molecular weight of 292.00 g/mol, XLogP of -1.02, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for butane;lanthanum(3+);phosphate is sourced from PubChem (CID 118953489), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).