C14H13NO5 — CID 118954351
(7-hydroxy-2-oxochromen-4-yl)methyl-prop-2-enylcarbamic acid (PubChem CID 118954351) has the molecular formula C14H13NO5 and a molecular weight of 275.26 g/mol. Its IUPAC name is (7-hydroxy-2-oxochromen-4-yl)methyl-prop-2-enylcarbamic acid.
| Compound Name | (7-hydroxy-2-oxochromen-4-yl)methyl-prop-2-enylcarbamic acid |
|---|---|
| PubChem CID | 118954351 |
| Molecular Formula | C14H13NO5 |
| Molecular Weight | 275.26 g/mol |
| Exact Mass | 275.08 |
| IUPAC Name | (7-hydroxy-2-oxochromen-4-yl)methyl-prop-2-enylcarbamic acid |
| SMILES | C=CCN(Cc1cc(=O)oc2cc(O)ccc12)C(=O)O |
| InChI | InChI=1S/C14H13NO5/c1-2-5-15(14(18)19)8-9-6-13(17)20-12-7-10(16)3-4-11(9)12/h2-4,6-7,16H,1,5,8H2,(H,18,19) |
| InChIKey | OBIINLBWZDBVOP-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.26 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|