C18H16ClNO3S — CID 9297672
4-[[(5-chlorothiophen-2-yl)methyl-prop-2-enylamino]methyl]-7-hydroxychromen-2-one (PubChem CID 9297672) has the molecular formula C18H16ClNO3S and a molecular weight of 361.85 g/mol. Its IUPAC name is 4-[[(5-chlorothiophen-2-yl)methyl-prop-2-enylamino]methyl]-7-hydroxychromen-2-one.
| Compound Name | 4-[[(5-chlorothiophen-2-yl)methyl-prop-2-enylamino]methyl]-7-hydroxychromen-2-one |
|---|---|
| PubChem CID | 9297672 |
| Molecular Formula | C18H16ClNO3S |
| Molecular Weight | 361.85 g/mol |
| Exact Mass | 361.05 |
| IUPAC Name | 4-[[(5-chlorothiophen-2-yl)methyl-prop-2-enylamino]methyl]-7-hydroxychromen-2-one |
| SMILES | C=CCN(Cc1ccc(Cl)s1)Cc1cc(=O)oc2cc(O)ccc12 |
| InChI | InChI=1S/C18H16ClNO3S/c1-2-7-20(11-14-4-6-17(19)24-14)10-12-8-18(22)23-16-9-13(21)3-5-15(12)16/h2-6,8-9,21H,1,7,10-11H2 |
| InChIKey | GEBMPRCIRRVZLT-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 53.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.85 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|