C23H19ClFN5O2 — CID 118954905
[2-chloro-4-fluoro-5-(7-morpholin-4-ylquinazolin-4-yl)phenyl]-pyrazin-2-ylmethanol (PubChem CID 118954905) has the molecular formula C23H19ClFN5O2 and a molecular weight of 451.89 g/mol. Its IUPAC name is [2-chloro-4-fluoro-5-(7-morpholin-4-ylquinazolin-4-yl)phenyl]-pyrazin-2-ylmethanol.
| Compound Name | [2-chloro-4-fluoro-5-(7-morpholin-4-ylquinazolin-4-yl)phenyl]-pyrazin-2-ylmethanol |
|---|---|
| PubChem CID | 118954905 |
| Molecular Formula | C23H19ClFN5O2 |
| Molecular Weight | 451.89 g/mol |
| Exact Mass | 451.12 |
| IUPAC Name | [2-chloro-4-fluoro-5-(7-morpholin-4-ylquinazolin-4-yl)phenyl]-pyrazin-2-ylmethanol |
| SMILES | OC(c1cnccn1)c1cc(-c2ncnc3cc(N4CCOCC4)ccc23)c(F)cc1Cl |
| InChI | InChI=1S/C23H19ClFN5O2/c24-18-11-19(25)17(10-16(18)23(31)21-12-26-3-4-27-21)22-15-2-1-14(9-20(15)28-13-29-22)30-5-7-32-8-6-30/h1-4,9-13,23,31H,5-8H2 |
| InChIKey | VXJBPIDEFGKNNZ-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 84.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.89 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |