C25H20F2N4O2 — CID 135268418
2-[2,4-difluoro-5-(7-morpholin-4-ylquinazolin-4-yl)phenyl]-2-pyridin-2-ylacetaldehyde (PubChem CID 135268418) has the molecular formula C25H20F2N4O2 and a molecular weight of 446.46 g/mol. Its IUPAC name is 2-[2,4-difluoro-5-(7-morpholin-4-ylquinazolin-4-yl)phenyl]-2-pyridin-2-ylacetaldehyde.
| Compound Name | 2-[2,4-difluoro-5-(7-morpholin-4-ylquinazolin-4-yl)phenyl]-2-pyridin-2-ylacetaldehyde |
|---|---|
| PubChem CID | 135268418 |
| Molecular Formula | C25H20F2N4O2 |
| Molecular Weight | 446.46 g/mol |
| Exact Mass | 446.16 |
| IUPAC Name | 2-[2,4-difluoro-5-(7-morpholin-4-ylquinazolin-4-yl)phenyl]-2-pyridin-2-ylacetaldehyde |
| SMILES | O=CC(c1ccccn1)c1cc(-c2ncnc3cc(N4CCOCC4)ccc23)c(F)cc1F |
| InChI | InChI=1S/C25H20F2N4O2/c26-21-13-22(27)19(12-18(21)20(14-32)23-3-1-2-6-28-23)25-17-5-4-16(11-24(17)29-15-30-25)31-7-9-33-10-8-31/h1-6,11-15,20H,7-10H2 |
| InChIKey | QFUICUDEOMKXLM-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 68.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.46 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|