C16H16Cl2O3S — CID 11895499
(2S)-1-(4-chlorophenoxy)-3-[(S)-(4-chlorophenyl)methylsulfinyl]propan-2-ol (PubChem CID 11895499) has the molecular formula C16H16Cl2O3S and a molecular weight of 359.27 g/mol. Its IUPAC name is (2S)-1-(4-chlorophenoxy)-3-[(S)-(4-chlorophenyl)methylsulfinyl]propan-2-ol.
| Compound Name | (2S)-1-(4-chlorophenoxy)-3-[(S)-(4-chlorophenyl)methylsulfinyl]propan-2-ol |
|---|---|
| PubChem CID | 11895499 |
| Molecular Formula | C16H16Cl2O3S |
| Molecular Weight | 359.27 g/mol |
| Exact Mass | 358.02 |
| IUPAC Name | (2S)-1-(4-chlorophenoxy)-3-[(S)-(4-chlorophenyl)methylsulfinyl]propan-2-ol |
| SMILES | O=[S@@](Cc1ccc(Cl)cc1)C[C@@H](O)COc1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H16Cl2O3S/c17-13-3-1-12(2-4-13)10-22(20)11-15(19)9-21-16-7-5-14(18)6-8-16/h1-8,15,19H,9-11H2/t15-,22-/m0/s1 |
| InChIKey | FYPQDPDLNJNVOV-NYHFZMIOSA-N |
| XLogP | 3.68 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.27 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |