C23H21F4N3O3 — CID 118956996
2-(2',5'-dioxospiro[1,2-dihydroindene-3,4'-imidazolidine]-1'-yl)-N-[(4-fluorophenyl)methyl]-N-[(2S)-1,1,1-trifluoropropan-2-yl]acetamide (PubChem CID 118956996) has the molecular formula C23H21F4N3O3 and a molecular weight of 463.43 g/mol. Its IUPAC name is 2-(2',5'-dioxospiro[1,2-dihydroindene-3,4'-imidazolidine]-1'-yl)-N-[(4-fluorophenyl)methyl]-N-[(2S)-1,1,1-trifluoropropan-2-yl]acetamide.
| Compound Name | 2-(2',5'-dioxospiro[1,2-dihydroindene-3,4'-imidazolidine]-1'-yl)-N-[(4-fluorophenyl)methyl]-N-[(2S)-1,1,1-trifluoropropan-2-yl]acetamide |
|---|---|
| PubChem CID | 118956996 |
| Molecular Formula | C23H21F4N3O3 |
| Molecular Weight | 463.43 g/mol |
| Exact Mass | 463.15 |
| IUPAC Name | 2-(2',5'-dioxospiro[1,2-dihydroindene-3,4'-imidazolidine]-1'-yl)-N-[(4-fluorophenyl)methyl]-N-[(2S)-1,1,1-trifluoropropan-2-yl]acetamide |
| SMILES | C[C@H](N(Cc1ccc(F)cc1)C(=O)CN1C(=O)NC2(CCc3ccccc32)C1=O)C(F)(F)F |
| InChI | InChI=1S/C23H21F4N3O3/c1-14(23(25,26)27)29(12-15-6-8-17(24)9-7-15)19(31)13-30-20(32)22(28-21(30)33)11-10-16-4-2-3-5-18(16)22/h2-9,14H,10-13H2,1H3,(H,28,33)/t14-,22?/m0/s1 |
| InChIKey | QCLUPRVDFLEYFK-XLEXHMCLSA-N |
| XLogP | 3.50 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.43 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|