C23H17BrF5N3O4 — CID 118957153
2-(5-bromo-6-fluoro-2',3,5'-trioxospiro[2H-indene-1,4'-imidazolidine]-1'-yl)-N-[(4-fluorophenyl)methyl]-N-[(2R)-1,1,1-trifluoropropan-2-yl]acetamide (PubChem CID 118957153) has the molecular formula C23H17BrF5N3O4 and a molecular weight of 574.30 g/mol. Its IUPAC name is 2-(5-bromo-6-fluoro-2',3,5'-trioxospiro[2H-indene-1,4'-imidazolidine]-1'-yl)-N-[(4-fluorophenyl)methyl]-N-[(2R)-1,1,1-trifluoropropan-2-yl]acetamide.
| Compound Name | 2-(5-bromo-6-fluoro-2',3,5'-trioxospiro[2H-indene-1,4'-imidazolidine]-1'-yl)-N-[(4-fluorophenyl)methyl]-N-[(2R)-1,1,1-trifluoropropan-2-yl]acetamide |
|---|---|
| PubChem CID | 118957153 |
| Molecular Formula | C23H17BrF5N3O4 |
| Molecular Weight | 574.30 g/mol |
| Exact Mass | 573.03 |
| IUPAC Name | 2-(5-bromo-6-fluoro-2',3,5'-trioxospiro[2H-indene-1,4'-imidazolidine]-1'-yl)-N-[(4-fluorophenyl)methyl]-N-[(2R)-1,1,1-trifluoropropan-2-yl]acetamide |
| SMILES | C[C@@H](N(Cc1ccc(F)cc1)C(=O)CN1C(=O)NC2(CC(=O)c3cc(Br)c(F)cc32)C1=O)C(F)(F)F |
| InChI | InChI=1S/C23H17BrF5N3O4/c1-11(23(27,28)29)31(9-12-2-4-13(25)5-3-12)19(34)10-32-20(35)22(30-21(32)36)8-18(33)14-6-16(24)17(26)7-15(14)22/h2-7,11H,8-10H2,1H3,(H,30,36)/t11-,22?/m1/s1 |
| InChIKey | OJEQIQSXUIVPQT-FAYKFVSFSA-N |
| XLogP | 4.04 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.30 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|