C27H24F5N5O3 — CID 118957274
2-[(1R,3S)-1-fluoro-6-(1-methylpyrazol-4-yl)-2',5'-dioxospiro[1,2-dihydroindene-3,4'-imidazolidine]-1'-yl]-N-[(4-fluorophenyl)methyl]-N-[(2S)-1,1,1-trifluoropropan-2-yl]acetamide (PubChem CID 118957274) has the molecular formula C27H24F5N5O3 and a molecular weight of 561.51 g/mol. Its IUPAC name is 2-[(1R,3S)-1-fluoro-6-(1-methylpyrazol-4-yl)-2',5'-dioxospiro[1,2-dihydroindene-3,4'-imidazolidine]-1'-yl]-N-[(4-fluorophenyl)methyl]-N-[(2S)-1,1,1-trifluoropropan-2-yl]acetamide.
| Compound Name | 2-[(1R,3S)-1-fluoro-6-(1-methylpyrazol-4-yl)-2',5'-dioxospiro[1,2-dihydroindene-3,4'-imidazolidine]-1'-yl]-N-[(4-fluorophenyl)methyl]-N-[(2S)-1,1,1-trifluoropropan-2-yl]acetamide |
|---|---|
| PubChem CID | 118957274 |
| Molecular Formula | C27H24F5N5O3 |
| Molecular Weight | 561.51 g/mol |
| Exact Mass | 561.18 |
| IUPAC Name | 2-[(1R,3S)-1-fluoro-6-(1-methylpyrazol-4-yl)-2',5'-dioxospiro[1,2-dihydroindene-3,4'-imidazolidine]-1'-yl]-N-[(4-fluorophenyl)methyl]-N-[(2S)-1,1,1-trifluoropropan-2-yl]acetamide |
| SMILES | C[C@H](N(Cc1ccc(F)cc1)C(=O)CN1C(=O)N[C@]2(C[C@@H](F)c3cc(-c4cnn(C)c4)ccc32)C1=O)C(F)(F)F |
| InChI | InChI=1S/C27H24F5N5O3/c1-15(27(30,31)32)36(12-16-3-6-19(28)7-4-16)23(38)14-37-24(39)26(34-25(37)40)10-22(29)20-9-17(5-8-21(20)26)18-11-33-35(2)13-18/h3-9,11,13,15,22H,10,12,14H2,1-2H3,(H,34,40)/t15-,22+,26-/m0/s1 |
| InChIKey | DLJMOXXSUWDBPJ-ZBUSMBIJSA-N |
| XLogP | 4.37 |
| TPSA | 87.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.51 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|