C28H25F4N5O4 — CID 122460066
N-[(4-fluorophenyl)methyl]-2-[6-(1-methylpyrazol-4-yl)-2',3,5'-trioxospiro[1,2-dihydronaphthalene-4,4'-imidazolidine]-1'-yl]-N-[(2S)-1,1,1-trifluoropropan-2-yl]acetamide (PubChem CID 122460066) has the molecular formula C28H25F4N5O4 and a molecular weight of 571.53 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methyl]-2-[6-(1-methylpyrazol-4-yl)-2',3,5'-trioxospiro[1,2-dihydronaphthalene-4,4'-imidazolidine]-1'-yl]-N-[(2S)-1,1,1-trifluoropropan-2-yl]acetamide.
| Compound Name | N-[(4-fluorophenyl)methyl]-2-[6-(1-methylpyrazol-4-yl)-2',3,5'-trioxospiro[1,2-dihydronaphthalene-4,4'-imidazolidine]-1'-yl]-N-[(2S)-1,1,1-trifluoropropan-2-yl]acetamide |
|---|---|
| PubChem CID | 122460066 |
| Molecular Formula | C28H25F4N5O4 |
| Molecular Weight | 571.53 g/mol |
| Exact Mass | 571.18 |
| IUPAC Name | N-[(4-fluorophenyl)methyl]-2-[6-(1-methylpyrazol-4-yl)-2',3,5'-trioxospiro[1,2-dihydronaphthalene-4,4'-imidazolidine]-1'-yl]-N-[(2S)-1,1,1-trifluoropropan-2-yl]acetamide |
| SMILES | C[C@H](N(Cc1ccc(F)cc1)C(=O)CN1C(=O)NC2(C(=O)CCc3ccc(-c4cnn(C)c4)cc32)C1=O)C(F)(F)F |
| InChI | InChI=1S/C28H25F4N5O4/c1-16(28(30,31)32)36(13-17-3-8-21(29)9-4-17)24(39)15-37-25(40)27(34-26(37)41)22-11-19(20-12-33-35(2)14-20)6-5-18(22)7-10-23(27)38/h3-6,8-9,11-12,14,16H,7,10,13,15H2,1-2H3,(H,34,41)/t16-,27?/m0/s1 |
| InChIKey | VKYAWBLBSCMUGF-CJKOFORZSA-N |
| XLogP | 3.47 |
| TPSA | 104.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.53 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|