C28H29N5O3 — CID 118958307
N-benzyl-3-cyclopropyl-2-[6-(1H-imidazol-2-yl)-2',5'-dioxospiro[1,2-dihydroindene-3,4'-imidazolidine]-1'-yl]butanamide (PubChem CID 118958307) has the molecular formula C28H29N5O3 and a molecular weight of 483.57 g/mol. Its IUPAC name is N-benzyl-3-cyclopropyl-2-[6-(1H-imidazol-2-yl)-2',5'-dioxospiro[1,2-dihydroindene-3,4'-imidazolidine]-1'-yl]butanamide.
| Compound Name | N-benzyl-3-cyclopropyl-2-[6-(1H-imidazol-2-yl)-2',5'-dioxospiro[1,2-dihydroindene-3,4'-imidazolidine]-1'-yl]butanamide |
|---|---|
| PubChem CID | 118958307 |
| Molecular Formula | C28H29N5O3 |
| Molecular Weight | 483.57 g/mol |
| Exact Mass | 483.23 |
| IUPAC Name | N-benzyl-3-cyclopropyl-2-[6-(1H-imidazol-2-yl)-2',5'-dioxospiro[1,2-dihydroindene-3,4'-imidazolidine]-1'-yl]butanamide |
| SMILES | CC(C1CC1)C(C(=O)NCc1ccccc1)N1C(=O)NC2(CCc3cc(-c4ncc[nH]4)ccc32)C1=O |
| InChI | InChI=1S/C28H29N5O3/c1-17(19-7-8-19)23(25(34)31-16-18-5-3-2-4-6-18)33-26(35)28(32-27(33)36)12-11-20-15-21(9-10-22(20)28)24-29-13-14-30-24/h2-6,9-10,13-15,17,19,23H,7-8,11-12,16H2,1H3,(H,29,30)(H,31,34)(H,32,36) |
| InChIKey | GNGSFUHSDXRJBO-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 107.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.57 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|